C28H35N5O4 — CID 58118427
N-[1-(4-isocyano-3-methylphenyl)piperidin-4-yl]-2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxyacetamide (PubChem CID 58118427) has the molecular formula C28H35N5O4 and a molecular weight of 505.62 g/mol. Its IUPAC name is N-[1-(4-isocyano-3-methylphenyl)piperidin-4-yl]-2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxyacetamide.
| Compound Name | N-[1-(4-isocyano-3-methylphenyl)piperidin-4-yl]-2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxyacetamide |
|---|---|
| PubChem CID | 58118427 |
| Molecular Formula | C28H35N5O4 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | N-[1-(4-isocyano-3-methylphenyl)piperidin-4-yl]-2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxyacetamide |
| SMILES | [C-]#[N+]c1ccc(N2CCC(NC(=O)COC3CCC(Nc4ccc([N+](=O)[O-])c(C)c4)CC3)CC2)cc1C |
| InChI | InChI=1S/C28H35N5O4/c1-19-17-24(7-10-26(19)29-3)32-14-12-22(13-15-32)31-28(34)18-37-25-8-4-21(5-9-25)30-23-6-11-27(33(35)36)20(2)16-23/h6-7,10-11,16-17,21-22,25,30H,4-5,8-9,12-15,18H2,1-2H3,(H,31,34) |
| InChIKey | CXGPXUVAWHRTQA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|