C27H35FN4O3 — CID 130232424
1-(4-fluorophenyl)-4-methyl-N-[[4-(3-methyl-4-nitroanilino)cyclohexyl]methyl]piperidine-4-carboxamide (PubChem CID 130232424) has the molecular formula C27H35FN4O3 and a molecular weight of 482.60 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-methyl-N-[[4-(3-methyl-4-nitroanilino)cyclohexyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-4-methyl-N-[[4-(3-methyl-4-nitroanilino)cyclohexyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 130232424 |
| Molecular Formula | C27H35FN4O3 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 1-(4-fluorophenyl)-4-methyl-N-[[4-(3-methyl-4-nitroanilino)cyclohexyl]methyl]piperidine-4-carboxamide |
| SMILES | Cc1cc(NC2CCC(CNC(=O)C3(C)CCN(c4ccc(F)cc4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H35FN4O3/c1-19-17-23(9-12-25(19)32(34)35)30-22-7-3-20(4-8-22)18-29-26(33)27(2)13-15-31(16-14-27)24-10-5-21(28)6-11-24/h5-6,9-12,17,20,22,30H,3-4,7-8,13-16,18H2,1-2H3,(H,29,33) |
| InChIKey | DTOXCGWKCZHDKV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|