C13H19N3O2 — CID 61211811
1-methyl-N-(3-methyl-4-nitrophenyl)piperidin-3-amine (PubChem CID 61211811) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-methyl-N-(3-methyl-4-nitrophenyl)piperidin-3-amine.
| Compound Name | 1-methyl-N-(3-methyl-4-nitrophenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 61211811 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-methyl-N-(3-methyl-4-nitrophenyl)piperidin-3-amine |
| SMILES | Cc1cc(NC2CCCN(C)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N3O2/c1-10-8-11(5-6-13(10)16(17)18)14-12-4-3-7-15(2)9-12/h5-6,8,12,14H,3-4,7,9H2,1-2H3 |
| InChIKey | WZARRMJWXIQOAG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|