C16H23N3O2 — CID 133320329
1-cyclopentyl-N-(3-methyl-4-nitrophenyl)pyrrolidin-3-amine (PubChem CID 133320329) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-cyclopentyl-N-(3-methyl-4-nitrophenyl)pyrrolidin-3-amine.
| Compound Name | 1-cyclopentyl-N-(3-methyl-4-nitrophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 133320329 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-cyclopentyl-N-(3-methyl-4-nitrophenyl)pyrrolidin-3-amine |
| SMILES | Cc1cc(NC2CCN(C3CCCC3)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H23N3O2/c1-12-10-13(6-7-16(12)19(20)21)17-14-8-9-18(11-14)15-4-2-3-5-15/h6-7,10,14-15,17H,2-5,8-9,11H2,1H3 |
| InChIKey | GGYRZGUSWBYHDC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|