C19H30N4O4S — CID 141171465
3-[(1-cyclopentylpyrrolidin-3-yl)amino]-N-(2-methylpropyl)-4-nitrobenzenesulfonamide (PubChem CID 141171465) has the molecular formula C19H30N4O4S and a molecular weight of 410.54 g/mol. Its IUPAC name is 3-[(1-cyclopentylpyrrolidin-3-yl)amino]-N-(2-methylpropyl)-4-nitrobenzenesulfonamide.
| Compound Name | 3-[(1-cyclopentylpyrrolidin-3-yl)amino]-N-(2-methylpropyl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 141171465 |
| Molecular Formula | C19H30N4O4S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 3-[(1-cyclopentylpyrrolidin-3-yl)amino]-N-(2-methylpropyl)-4-nitrobenzenesulfonamide |
| SMILES | CC(C)CNS(=O)(=O)c1ccc([N+](=O)[O-])c(NC2CCN(C3CCCC3)C2)c1 |
| InChI | InChI=1S/C19H30N4O4S/c1-14(2)12-20-28(26,27)17-7-8-19(23(24)25)18(11-17)21-15-9-10-22(13-15)16-5-3-4-6-16/h7-8,11,14-16,20-21H,3-6,9-10,12-13H2,1-2H3 |
| InChIKey | VQFQLBUUBNXFQG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|