C20H25N5O3 — CID 133301891
[4-[(1-cyclopentylpyrrolidin-3-yl)amino]-3-nitrophenyl]-(1-methylimidazol-2-yl)methanone (PubChem CID 133301891) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is [4-[(1-cyclopentylpyrrolidin-3-yl)amino]-3-nitrophenyl]-(1-methylimidazol-2-yl)methanone.
| Compound Name | [4-[(1-cyclopentylpyrrolidin-3-yl)amino]-3-nitrophenyl]-(1-methylimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 133301891 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | [4-[(1-cyclopentylpyrrolidin-3-yl)amino]-3-nitrophenyl]-(1-methylimidazol-2-yl)methanone |
| SMILES | Cn1ccnc1C(=O)c1ccc(NC2CCN(C3CCCC3)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H25N5O3/c1-23-11-9-21-20(23)19(26)14-6-7-17(18(12-14)25(27)28)22-15-8-10-24(13-15)16-4-2-3-5-16/h6-7,9,11-12,15-16,22H,2-5,8,10,13H2,1H3 |
| InChIKey | AFFNSMLTARAIQF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|