C28H36FN3O3 — CID 130232064
2-fluoro-1-[4-(3-methyl-4-nitroanilino)cyclohexyl]-3-[1-(4-methylphenyl)piperidin-4-yl]propan-1-one (PubChem CID 130232064) has the molecular formula C28H36FN3O3 and a molecular weight of 481.61 g/mol. Its IUPAC name is 2-fluoro-1-[4-(3-methyl-4-nitroanilino)cyclohexyl]-3-[1-(4-methylphenyl)piperidin-4-yl]propan-1-one.
| Compound Name | 2-fluoro-1-[4-(3-methyl-4-nitroanilino)cyclohexyl]-3-[1-(4-methylphenyl)piperidin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 130232064 |
| Molecular Formula | C28H36FN3O3 |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 2-fluoro-1-[4-(3-methyl-4-nitroanilino)cyclohexyl]-3-[1-(4-methylphenyl)piperidin-4-yl]propan-1-one |
| SMILES | Cc1ccc(N2CCC(CC(F)C(=O)C3CCC(Nc4ccc([N+](=O)[O-])c(C)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C28H36FN3O3/c1-19-3-10-25(11-4-19)31-15-13-21(14-16-31)18-26(29)28(33)22-5-7-23(8-6-22)30-24-9-12-27(32(34)35)20(2)17-24/h3-4,9-12,17,21-23,26,30H,5-8,13-16,18H2,1-2H3 |
| InChIKey | RHDAQNXMPAYYHW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|