C20H19F3N2O4 — CID 69166796
[4-(4-methoxyphenyl)piperidin-1-yl]-[3-nitro-4-(trifluoromethyl)phenyl]methanone (PubChem CID 69166796) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)piperidin-1-yl]-[3-nitro-4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(4-methoxyphenyl)piperidin-1-yl]-[3-nitro-4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 69166796 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [4-(4-methoxyphenyl)piperidin-1-yl]-[3-nitro-4-(trifluoromethyl)phenyl]methanone |
| SMILES | COc1ccc(C2CCN(C(=O)c3ccc(C(F)(F)F)c([N+](=O)[O-])c3)CC2)cc1 |
| InChI | InChI=1S/C20H19F3N2O4/c1-29-16-5-2-13(3-6-16)14-8-10-24(11-9-14)19(26)15-4-7-17(20(21,22)23)18(12-15)25(27)28/h2-7,12,14H,8-11H2,1H3 |
| InChIKey | HCYVFTYOLVWTCF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|