C18H23F3N2O4 — CID 99630945
(4-tert-butyl-3-nitrophenyl)-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]piperidin-1-yl]methanone (PubChem CID 99630945) has the molecular formula C18H23F3N2O4 and a molecular weight of 388.39 g/mol. Its IUPAC name is (4-tert-butyl-3-nitrophenyl)-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]piperidin-1-yl]methanone.
| Compound Name | (4-tert-butyl-3-nitrophenyl)-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 99630945 |
| Molecular Formula | C18H23F3N2O4 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (4-tert-butyl-3-nitrophenyl)-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]piperidin-1-yl]methanone |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCC([C@H](O)C(F)(F)F)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H23F3N2O4/c1-17(2,3)13-5-4-12(10-14(13)23(26)27)16(25)22-8-6-11(7-9-22)15(24)18(19,20)21/h4-5,10-11,15,24H,6-9H2,1-3H3/t15-/m0/s1 |
| InChIKey | NRBJENCCAARZQI-HNNXBMFYSA-N |
| XLogP | 3.67 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|