C13H12F4N2O4 — CID 166391033
(3-methylazetidin-1-yl)-[3-nitro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone (PubChem CID 166391033) has the molecular formula C13H12F4N2O4 and a molecular weight of 336.24 g/mol. Its IUPAC name is (3-methylazetidin-1-yl)-[3-nitro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone.
| Compound Name | (3-methylazetidin-1-yl)-[3-nitro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 166391033 |
| Molecular Formula | C13H12F4N2O4 |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | (3-methylazetidin-1-yl)-[3-nitro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
| SMILES | CC1CN(C(=O)c2ccc(OC(F)(F)C(F)F)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C13H12F4N2O4/c1-7-5-18(6-7)11(20)8-2-3-10(9(4-8)19(21)22)23-13(16,17)12(14)15/h2-4,7,12H,5-6H2,1H3 |
| InChIKey | DEWXFAAVUDPOOF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|