C20H21BrN2O3S — CID 92695052
[4-(4-bromophenyl)sulfanyl-3-nitrophenyl]-[(3R,5S)-3,5-dimethylpiperidin-1-yl]methanone (PubChem CID 92695052) has the molecular formula C20H21BrN2O3S and a molecular weight of 449.37 g/mol. Its IUPAC name is [4-(4-bromophenyl)sulfanyl-3-nitrophenyl]-[(3R,5S)-3,5-dimethylpiperidin-1-yl]methanone.
| Compound Name | [4-(4-bromophenyl)sulfanyl-3-nitrophenyl]-[(3R,5S)-3,5-dimethylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 92695052 |
| Molecular Formula | C20H21BrN2O3S |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | [4-(4-bromophenyl)sulfanyl-3-nitrophenyl]-[(3R,5S)-3,5-dimethylpiperidin-1-yl]methanone |
| SMILES | C[C@@H]1C[C@H](C)CN(C(=O)c2ccc(Sc3ccc(Br)cc3)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C20H21BrN2O3S/c1-13-9-14(2)12-22(11-13)20(24)15-3-8-19(18(10-15)23(25)26)27-17-6-4-16(21)5-7-17/h3-8,10,13-14H,9,11-12H2,1-2H3/t13-,14+ |
| InChIKey | WQAFCINHHAIVLU-OKILXGFUSA-N |
| XLogP | 5.63 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|