C16H20N2O5 — CID 119372210
(2R)-1-(4-tert-butyl-3-nitrobenzoyl)pyrrolidine-2-carboxylic acid (PubChem CID 119372210) has the molecular formula C16H20N2O5 and a molecular weight of 320.34 g/mol. Its IUPAC name is (2R)-1-(4-tert-butyl-3-nitrobenzoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-(4-tert-butyl-3-nitrobenzoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119372210 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (2R)-1-(4-tert-butyl-3-nitrobenzoyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCC[C@@H]2C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N2O5/c1-16(2,3)11-7-6-10(9-13(11)18(22)23)14(19)17-8-4-5-12(17)15(20)21/h6-7,9,12H,4-5,8H2,1-3H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | VNGUMVKZQSBKRL-GFCCVEGCSA-N |
| XLogP | 2.58 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|