C18H24N2O5 — CID 122115004
(2R,3R)-1-(4-tert-butyl-3-nitrobenzoyl)-2-methylpiperidine-3-carboxylic acid (PubChem CID 122115004) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is (2R,3R)-1-(4-tert-butyl-3-nitrobenzoyl)-2-methylpiperidine-3-carboxylic acid.
| Compound Name | (2R,3R)-1-(4-tert-butyl-3-nitrobenzoyl)-2-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122115004 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (2R,3R)-1-(4-tert-butyl-3-nitrobenzoyl)-2-methylpiperidine-3-carboxylic acid |
| SMILES | C[C@@H]1[C@H](C(=O)O)CCCN1C(=O)c1ccc(C(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H24N2O5/c1-11-13(17(22)23)6-5-9-19(11)16(21)12-7-8-14(18(2,3)4)15(10-12)20(24)25/h7-8,10-11,13H,5-6,9H2,1-4H3,(H,22,23)/t11-,13-/m1/s1 |
| InChIKey | UQQKIVUICJALFT-DGCLKSJQSA-N |
| XLogP | 3.22 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|