C16H19N3O6S — CID 122114816
(2R,3R)-1-[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]-2-methylpiperidine-3-carboxylic acid (PubChem CID 122114816) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is (2R,3R)-1-[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]-2-methylpiperidine-3-carboxylic acid.
| Compound Name | (2R,3R)-1-[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]-2-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122114816 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (2R,3R)-1-[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]-2-methylpiperidine-3-carboxylic acid |
| SMILES | C[C@@H]1[C@H](C(=O)O)CCCN1C(=O)CSc1ccc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N3O6S/c1-9-11(16(22)23)3-2-6-18(9)14(20)8-26-13-5-4-10(15(17)21)7-12(13)19(24)25/h4-5,7,9,11H,2-3,6,8H2,1H3,(H2,17,21)(H,22,23)/t9-,11-/m1/s1 |
| InChIKey | FKMKDZPXQVCYEH-MWLCHTKSSA-N |
| XLogP | 1.50 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|