C22H32N4O4 — CID 78858898
2-[4-(4-tert-butyl-3-nitrobenzoyl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 78858898) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[4-(4-tert-butyl-3-nitrobenzoyl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-(4-tert-butyl-3-nitrobenzoyl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 78858898 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 2-[4-(4-tert-butyl-3-nitrobenzoyl)-1,4-diazepan-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCCN(CC(=O)N3CCCC3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H32N4O4/c1-22(2,3)18-8-7-17(15-19(18)26(29)30)21(28)25-12-6-9-23(13-14-25)16-20(27)24-10-4-5-11-24/h7-8,15H,4-6,9-14,16H2,1-3H3 |
| InChIKey | WBDHGFNIAWPZLH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|