C20H29N5O4 — CID 35609927
1-(azepan-1-yl)-2-[4-[4-(methylamino)-3-nitrobenzoyl]piperazin-1-yl]ethanone (PubChem CID 35609927) has the molecular formula C20H29N5O4 and a molecular weight of 403.48 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[4-[4-(methylamino)-3-nitrobenzoyl]piperazin-1-yl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[4-[4-(methylamino)-3-nitrobenzoyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 35609927 |
| Molecular Formula | C20H29N5O4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 1-(azepan-1-yl)-2-[4-[4-(methylamino)-3-nitrobenzoyl]piperazin-1-yl]ethanone |
| SMILES | CNc1ccc(C(=O)N2CCN(CC(=O)N3CCCCCC3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H29N5O4/c1-21-17-7-6-16(14-18(17)25(28)29)20(27)24-12-10-22(11-13-24)15-19(26)23-8-4-2-3-5-9-23/h6-7,14,21H,2-5,8-13,15H2,1H3 |
| InChIKey | QHXZAQQSACMKKO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|