C21H28N4O4 — CID 95751950
[4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1,4-diazepan-1-yl]-(3-methyl-4-nitrophenyl)methanone (PubChem CID 95751950) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1,4-diazepan-1-yl]-(3-methyl-4-nitrophenyl)methanone.
| Compound Name | [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1,4-diazepan-1-yl]-(3-methyl-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 95751950 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | [4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1,4-diazepan-1-yl]-(3-methyl-4-nitrophenyl)methanone |
| SMILES | Cc1cc(C(=O)N2CCCN(Cc3ncc(C(C)(C)C)o3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H28N4O4/c1-15-12-16(6-7-17(15)25(27)28)20(26)24-9-5-8-23(10-11-24)14-19-22-13-18(29-19)21(2,3)4/h6-7,12-13H,5,8-11,14H2,1-4H3 |
| InChIKey | WYMJUDKUZKXPJC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 92.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|