C26H32ClF3N4OS — CID 70845347
1-[4-(4-chloro-3-sulfanylanilino)piperidin-1-yl]-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one (PubChem CID 70845347) has the molecular formula C26H32ClF3N4OS and a molecular weight of 541.08 g/mol. Its IUPAC name is 1-[4-(4-chloro-3-sulfanylanilino)piperidin-1-yl]-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one.
| Compound Name | 1-[4-(4-chloro-3-sulfanylanilino)piperidin-1-yl]-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 70845347 |
| Molecular Formula | C26H32ClF3N4OS |
| Molecular Weight | 541.08 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 1-[4-(4-chloro-3-sulfanylanilino)piperidin-1-yl]-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one |
| SMILES | O=C(CCCN1CCN(c2ccc(C(F)(F)F)cc2)CC1)N1CCC(Nc2ccc(Cl)c(S)c2)CC1 |
| InChI | InChI=1S/C26H32ClF3N4OS/c27-23-8-5-21(18-24(23)36)31-20-9-12-34(13-10-20)25(35)2-1-11-32-14-16-33(17-15-32)22-6-3-19(4-7-22)26(28,29)30/h3-8,18,20,31,36H,1-2,9-17H2 |
| InChIKey | YTWNFUBMTPUKGF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.08 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|