C28H37F3N8O — CID 171929008
N'-(methyldiazenyl)-4-[[1-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butanoyl]piperidin-4-yl]amino]benzenecarboximidamide (PubChem CID 171929008) has the molecular formula C28H37F3N8O and a molecular weight of 558.65 g/mol. Its IUPAC name is N'-(methyldiazenyl)-4-[[1-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butanoyl]piperidin-4-yl]amino]benzenecarboximidamide.
| Compound Name | N'-(methyldiazenyl)-4-[[1-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butanoyl]piperidin-4-yl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 171929008 |
| Molecular Formula | C28H37F3N8O |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | N'-(methyldiazenyl)-4-[[1-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butanoyl]piperidin-4-yl]amino]benzenecarboximidamide |
| SMILES | C/N=N/N=C(N)c1ccc(NC2CCN(C(=O)CCCN3CCN(c4ccc(C(F)(F)F)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C28H37F3N8O/c1-33-36-35-27(32)21-4-8-23(9-5-21)34-24-12-15-39(16-13-24)26(40)3-2-14-37-17-19-38(20-18-37)25-10-6-22(7-11-25)28(29,30)31/h4-11,24,34H,2-3,12-20H2,1H3,(H2,32,33,35) |
| InChIKey | ZNSIEICFOOFQIN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|