C27H35F3N4O4 — CID 88984046
2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(2-ethylphenyl)piperazin-1-yl]ethanone (PubChem CID 88984046) has the molecular formula C27H35F3N4O4 and a molecular weight of 536.60 g/mol. Its IUPAC name is 2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(2-ethylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(2-ethylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 88984046 |
| Molecular Formula | C27H35F3N4O4 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(2-ethylphenyl)piperazin-1-yl]ethanone |
| SMILES | CCc1ccccc1N1CCN(C(=O)COC2CCC(Nc3ccc(N(O)O)c(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C27H35F3N4O4/c1-2-19-5-3-4-6-24(19)32-13-15-33(16-14-32)26(35)18-38-22-10-7-20(8-11-22)31-21-9-12-25(34(36)37)23(17-21)27(28,29)30/h3-6,9,12,17,20,22,31,36-37H,2,7-8,10-11,13-16,18H2,1H3 |
| InChIKey | FDPLHMUKODGUBM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|