C27H32ClF3N4O4 — CID 88983865
1-[2-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 88983865) has the molecular formula C27H32ClF3N4O4 and a molecular weight of 569.02 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[2-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 88983865 |
| Molecular Formula | C27H32ClF3N4O4 |
| Molecular Weight | 569.02 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | O=C(COC1CCC(Nc2ccc(N(O)O)c(C(F)(F)F)c2)CC1)N1CC2CN(c3ccc(Cl)cc3)CC2C1 |
| InChI | InChI=1S/C27H32ClF3N4O4/c28-19-1-6-22(7-2-19)33-12-17-14-34(15-18(17)13-33)26(36)16-39-23-8-3-20(4-9-23)32-21-5-10-25(35(37)38)24(11-21)27(29,30)31/h1-2,5-7,10-11,17-18,20,23,32,37-38H,3-4,8-9,12-16H2 |
| InChIKey | IGAIVQWUQHSWEQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.02 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|