C26H32ClF3N4O3 — CID 88984084
1-[4-(4-chlorophenyl)piperazin-1-yl]-3-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]propan-1-one (PubChem CID 88984084) has the molecular formula C26H32ClF3N4O3 and a molecular weight of 541.01 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)piperazin-1-yl]-3-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]propan-1-one.
| Compound Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-3-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]propan-1-one |
|---|---|
| PubChem CID | 88984084 |
| Molecular Formula | C26H32ClF3N4O3 |
| Molecular Weight | 541.01 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-3-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]propan-1-one |
| SMILES | O=C(CCC1CCC(Nc2ccc(N(O)O)c(C(F)(F)F)c2)CC1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H32ClF3N4O3/c27-19-4-9-22(10-5-19)32-13-15-33(16-14-32)25(35)12-3-18-1-6-20(7-2-18)31-21-8-11-24(34(36)37)23(17-21)26(28,29)30/h4-5,8-11,17-18,20,31,36-37H,1-3,6-7,12-16H2 |
| InChIKey | MDZORRKWOAAFLN-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.01 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|