C26H33ClF3N5O2S — CID 88872749
3-[4-(4-chlorophenyl)piperazin-1-yl]-1-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]piperidin-1-yl]-2-methylpropane-1-thione (PubChem CID 88872749) has the molecular formula C26H33ClF3N5O2S and a molecular weight of 572.10 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)piperazin-1-yl]-1-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]piperidin-1-yl]-2-methylpropane-1-thione.
| Compound Name | 3-[4-(4-chlorophenyl)piperazin-1-yl]-1-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]piperidin-1-yl]-2-methylpropane-1-thione |
|---|---|
| PubChem CID | 88872749 |
| Molecular Formula | C26H33ClF3N5O2S |
| Molecular Weight | 572.10 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 3-[4-(4-chlorophenyl)piperazin-1-yl]-1-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]piperidin-1-yl]-2-methylpropane-1-thione |
| SMILES | CC(CN1CCN(c2ccc(Cl)cc2)CC1)C(=S)N1CCC(Nc2ccc(N(O)O)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C26H33ClF3N5O2S/c1-18(17-32-12-14-33(15-13-32)22-5-2-19(27)3-6-22)25(38)34-10-8-20(9-11-34)31-21-4-7-24(35(36)37)23(16-21)26(28,29)30/h2-7,16,18,20,31,36-37H,8-15,17H2,1H3 |
| InChIKey | XDHVPULZUAHGSC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.10 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|