C28H37N5S — CID 118281147
2-methyl-4-[[1-[2-methyl-3-[4-(4-methylphenyl)piperazin-1-yl]propanethioyl]piperidin-4-yl]amino]benzonitrile (PubChem CID 118281147) has the molecular formula C28H37N5S and a molecular weight of 475.71 g/mol. Its IUPAC name is 2-methyl-4-[[1-[2-methyl-3-[4-(4-methylphenyl)piperazin-1-yl]propanethioyl]piperidin-4-yl]amino]benzonitrile.
| Compound Name | 2-methyl-4-[[1-[2-methyl-3-[4-(4-methylphenyl)piperazin-1-yl]propanethioyl]piperidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 118281147 |
| Molecular Formula | C28H37N5S |
| Molecular Weight | 475.71 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | 2-methyl-4-[[1-[2-methyl-3-[4-(4-methylphenyl)piperazin-1-yl]propanethioyl]piperidin-4-yl]amino]benzonitrile |
| SMILES | Cc1ccc(N2CCN(CC(C)C(=S)N3CCC(Nc4ccc(C#N)c(C)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C28H37N5S/c1-21-4-8-27(9-5-21)32-16-14-31(15-17-32)20-23(3)28(34)33-12-10-25(11-13-33)30-26-7-6-24(19-29)22(2)18-26/h4-9,18,23,25,30H,10-17,20H2,1-3H3 |
| InChIKey | KTAFLBQHWXQYJY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 45.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.71 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|