C24H33F3N4S — CID 88872745
1-[4-(buta-1,3-dien-2-ylamino)piperidin-1-yl]-2-methyl-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propane-1-thione (PubChem CID 88872745) has the molecular formula C24H33F3N4S and a molecular weight of 466.62 g/mol. Its IUPAC name is 1-[4-(buta-1,3-dien-2-ylamino)piperidin-1-yl]-2-methyl-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propane-1-thione.
| Compound Name | 1-[4-(buta-1,3-dien-2-ylamino)piperidin-1-yl]-2-methyl-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propane-1-thione |
|---|---|
| PubChem CID | 88872745 |
| Molecular Formula | C24H33F3N4S |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 1-[4-(buta-1,3-dien-2-ylamino)piperidin-1-yl]-2-methyl-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propane-1-thione |
| SMILES | C=CC(=C)NC1CCN(C(=S)C(C)CN2CCN(c3ccc(C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H33F3N4S/c1-4-19(3)28-21-9-11-31(12-10-21)23(32)18(2)17-29-13-15-30(16-14-29)22-7-5-20(6-8-22)24(25,26)27/h4-8,18,21,28H,1,3,9-17H2,2H3 |
| InChIKey | AFGKEHHMYNWGLN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|