C26H34F3N5O — CID 70845321
4-[4-(4-methylphenyl)piperazin-1-yl]-1-[(3S)-3-[[5-(trifluoromethyl)-3-pyridinyl]amino]piperidin-1-yl]butan-1-one (PubChem CID 70845321) has the molecular formula C26H34F3N5O and a molecular weight of 489.59 g/mol. Its IUPAC name is 4-[4-(4-methylphenyl)piperazin-1-yl]-1-[(3S)-3-[[5-(trifluoromethyl)-3-pyridinyl]amino]piperidin-1-yl]butan-1-one.
| Compound Name | 4-[4-(4-methylphenyl)piperazin-1-yl]-1-[(3S)-3-[[5-(trifluoromethyl)-3-pyridinyl]amino]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 70845321 |
| Molecular Formula | C26H34F3N5O |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 4-[4-(4-methylphenyl)piperazin-1-yl]-1-[(3S)-3-[[5-(trifluoromethyl)-3-pyridinyl]amino]piperidin-1-yl]butan-1-one |
| SMILES | Cc1ccc(N2CCN(CCCC(=O)N3CCC[C@H](Nc4cncc(C(F)(F)F)c4)C3)CC2)cc1 |
| InChI | InChI=1S/C26H34F3N5O/c1-20-6-8-24(9-7-20)33-14-12-32(13-15-33)10-3-5-25(35)34-11-2-4-22(19-34)31-23-16-21(17-30-18-23)26(27,28)29/h6-9,16-18,22,31H,2-5,10-15,19H2,1H3/t22-/m0/s1 |
| InChIKey | ZTXFROHZWODWRO-QFIPXVFZSA-N |
| XLogP | 4.41 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|