C29H35ClF3N3OS — CID 58577233
4-[5-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[(3R)-3-[[4-(trifluoromethylsulfanyl)phenyl]methyl]piperidin-1-yl]butan-1-one (PubChem CID 58577233) has the molecular formula C29H35ClF3N3OS and a molecular weight of 566.13 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[(3R)-3-[[4-(trifluoromethylsulfanyl)phenyl]methyl]piperidin-1-yl]butan-1-one.
| Compound Name | 4-[5-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[(3R)-3-[[4-(trifluoromethylsulfanyl)phenyl]methyl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 58577233 |
| Molecular Formula | C29H35ClF3N3OS |
| Molecular Weight | 566.13 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | 4-[5-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-[(3R)-3-[[4-(trifluoromethylsulfanyl)phenyl]methyl]piperidin-1-yl]butan-1-one |
| SMILES | O=C(CCCN1CC2CN(c3ccc(Cl)cc3)CC2C1)N1CCC[C@H](Cc2ccc(SC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C29H35ClF3N3OS/c30-25-7-9-26(10-8-25)36-19-23-17-34(18-24(23)20-36)13-2-4-28(37)35-14-1-3-22(16-35)15-21-5-11-27(12-6-21)38-29(31,32)33/h5-12,22-24H,1-4,13-20H2/t22-,23?,24?/m1/s1 |
| InChIKey | XNQQAYUDQGEIEF-ZKMFCFPVSA-N |
| XLogP | 6.58 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.13 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |