C24H31ClN6O3 — CID 58576378
4-[4-(4-chlorophenyl)piperazin-1-yl]-1-[4-[(5-nitro-2-pyridinyl)amino]piperidin-1-yl]butan-1-one (PubChem CID 58576378) has the molecular formula C24H31ClN6O3 and a molecular weight of 487.00 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)piperazin-1-yl]-1-[4-[(5-nitro-2-pyridinyl)amino]piperidin-1-yl]butan-1-one.
| Compound Name | 4-[4-(4-chlorophenyl)piperazin-1-yl]-1-[4-[(5-nitro-2-pyridinyl)amino]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 58576378 |
| Molecular Formula | C24H31ClN6O3 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 4-[4-(4-chlorophenyl)piperazin-1-yl]-1-[4-[(5-nitro-2-pyridinyl)amino]piperidin-1-yl]butan-1-one |
| SMILES | O=C(CCCN1CCN(c2ccc(Cl)cc2)CC1)N1CCC(Nc2ccc([N+](=O)[O-])cn2)CC1 |
| InChI | InChI=1S/C24H31ClN6O3/c25-19-3-5-21(6-4-19)29-16-14-28(15-17-29)11-1-2-24(32)30-12-9-20(10-13-30)27-23-8-7-22(18-26-23)31(33)34/h3-8,18,20H,1-2,9-17H2,(H,26,27) |
| InChIKey | KYWMFMDDWQITGM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|