C26H33ClF3N5 — CID 90785759
N-[1-[3-[5-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]piperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 90785759) has the molecular formula C26H33ClF3N5 and a molecular weight of 508.03 g/mol. Its IUPAC name is N-[1-[3-[5-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]piperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[1-[3-[5-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]piperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 90785759 |
| Molecular Formula | C26H33ClF3N5 |
| Molecular Weight | 508.03 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | N-[1-[3-[5-(4-chlorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]piperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(NC2CCN(CCCN3CC4CN(c5ccc(Cl)cc5)CC4C3)CC2)nc1 |
| InChI | InChI=1S/C26H33ClF3N5/c27-22-3-5-24(6-4-22)35-17-19-15-34(16-20(19)18-35)11-1-10-33-12-8-23(9-13-33)32-25-7-2-21(14-31-25)26(28,29)30/h2-7,14,19-20,23H,1,8-13,15-18H2,(H,31,32) |
| InChIKey | BHZWPDWOSKQKGD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 34.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.03 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |