C21H24F3N5OS — CID 167479323
4-[4-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]piperazin-2-one (PubChem CID 167479323) has the molecular formula C21H24F3N5OS and a molecular weight of 451.52 g/mol. Its IUPAC name is 4-[4-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]piperazin-2-one.
| Compound Name | 4-[4-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]piperazin-2-one |
|---|---|
| PubChem CID | 167479323 |
| Molecular Formula | C21H24F3N5OS |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 4-[4-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]piperazin-2-one |
| SMILES | O=C1CN(c2ccc(SN3CCC(Nc4ccc(C(F)(F)F)cn4)CC3)cc2)CCN1 |
| InChI | InChI=1S/C21H24F3N5OS/c22-21(23,24)15-1-6-19(26-13-15)27-16-7-10-29(11-8-16)31-18-4-2-17(3-5-18)28-12-9-25-20(30)14-28/h1-6,13,16H,7-12,14H2,(H,25,30)(H,26,27) |
| InChIKey | CPHQHAFHSOHTDK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|