C26H25F3N6OS — CID 167479240
1-methyl-5-[4-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]indazole-3-carboxamide (PubChem CID 167479240) has the molecular formula C26H25F3N6OS and a molecular weight of 526.59 g/mol. Its IUPAC name is 1-methyl-5-[4-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]indazole-3-carboxamide.
| Compound Name | 1-methyl-5-[4-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 167479240 |
| Molecular Formula | C26H25F3N6OS |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 1-methyl-5-[4-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]indazole-3-carboxamide |
| SMILES | Cn1nc(C(N)=O)c2cc(-c3ccc(SN4CCC(Nc5ccc(C(F)(F)F)cn5)CC4)cc3)ccc21 |
| InChI | InChI=1S/C26H25F3N6OS/c1-34-22-8-4-17(14-21(22)24(33-34)25(30)36)16-2-6-20(7-3-16)37-35-12-10-19(11-13-35)32-23-9-5-18(15-31-23)26(27,28)29/h2-9,14-15,19H,10-13H2,1H3,(H2,30,36)(H,31,32) |
| InChIKey | HNHSNVXLLCLXBP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|