C27H31F3N6OS — CID 167479009
1-[4-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]phenyl]sulfanyl-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-3-ol (PubChem CID 167479009) has the molecular formula C27H31F3N6OS and a molecular weight of 544.65 g/mol. Its IUPAC name is 1-[4-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]phenyl]sulfanyl-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-3-ol.
| Compound Name | 1-[4-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]phenyl]sulfanyl-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-3-ol |
|---|---|
| PubChem CID | 167479009 |
| Molecular Formula | C27H31F3N6OS |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 1-[4-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]phenyl]sulfanyl-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-3-ol |
| SMILES | CN1CCN(c2cc(-c3ccc(SN4CCC(Nc5ccc(C(F)(F)F)cn5)C(O)C4)cc3)ccn2)CC1 |
| InChI | InChI=1S/C27H31F3N6OS/c1-34-12-14-35(15-13-34)26-16-20(8-10-31-26)19-2-5-22(6-3-19)38-36-11-9-23(24(37)18-36)33-25-7-4-21(17-32-25)27(28,29)30/h2-8,10,16-17,23-24,37H,9,11-15,18H2,1H3,(H,32,33) |
| InChIKey | KVXQKTMYXFCUQB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|