C26H25F3N6OS — CID 167479082
1-[4-[2-(1-methylimidazol-2-yl)-4-pyridinyl]phenyl]sulfanyl-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-3-ol (PubChem CID 167479082) has the molecular formula C26H25F3N6OS and a molecular weight of 526.59 g/mol. Its IUPAC name is 1-[4-[2-(1-methylimidazol-2-yl)-4-pyridinyl]phenyl]sulfanyl-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-3-ol.
| Compound Name | 1-[4-[2-(1-methylimidazol-2-yl)-4-pyridinyl]phenyl]sulfanyl-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-3-ol |
|---|---|
| PubChem CID | 167479082 |
| Molecular Formula | C26H25F3N6OS |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 1-[4-[2-(1-methylimidazol-2-yl)-4-pyridinyl]phenyl]sulfanyl-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-3-ol |
| SMILES | Cn1ccnc1-c1cc(-c2ccc(SN3CCC(Nc4ccc(C(F)(F)F)cn4)C(O)C3)cc2)ccn1 |
| InChI | InChI=1S/C26H25F3N6OS/c1-34-13-11-31-25(34)22-14-18(8-10-30-22)17-2-5-20(6-3-17)37-35-12-9-21(23(36)16-35)33-24-7-4-19(15-32-24)26(27,28)29/h2-8,10-11,13-15,21,23,36H,9,12,16H2,1H3,(H,32,33) |
| InChIKey | FESFUHPQRVHACZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|