C26H25F3N4O2S — CID 167479011
6-[4-[3-hydroxy-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 167479011) has the molecular formula C26H25F3N4O2S and a molecular weight of 514.57 g/mol. Its IUPAC name is 6-[4-[3-hydroxy-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[4-[3-hydroxy-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 167479011 |
| Molecular Formula | C26H25F3N4O2S |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 6-[4-[3-hydroxy-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(-c3ccc(SN4CCC(Nc5ccc(C(F)(F)F)cn5)C(O)C4)cc3)ccc2N1 |
| InChI | InChI=1S/C26H25F3N4O2S/c27-26(28,29)19-5-9-24(30-14-19)31-22-11-12-33(15-23(22)34)36-20-6-1-16(2-7-20)17-3-8-21-18(13-17)4-10-25(35)32-21/h1-3,5-9,13-14,22-23,34H,4,10-12,15H2,(H,30,31)(H,32,35) |
| InChIKey | LXTAVWYZFWKZGJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|