C25H21N7OS — CID 167479081
5-[4-[4-[(5-cyano-2-pyridinyl)amino]-3-hydroxypiperidin-1-yl]sulfanylphenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile (PubChem CID 167479081) has the molecular formula C25H21N7OS and a molecular weight of 467.56 g/mol. Its IUPAC name is 5-[4-[4-[(5-cyano-2-pyridinyl)amino]-3-hydroxypiperidin-1-yl]sulfanylphenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile.
| Compound Name | 5-[4-[4-[(5-cyano-2-pyridinyl)amino]-3-hydroxypiperidin-1-yl]sulfanylphenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 167479081 |
| Molecular Formula | C25H21N7OS |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 5-[4-[4-[(5-cyano-2-pyridinyl)amino]-3-hydroxypiperidin-1-yl]sulfanylphenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NC2CCN(Sc3ccc(-c4cnc5[nH]cc(C#N)c5c4)cc3)CC2O)nc1 |
| InChI | InChI=1S/C25H21N7OS/c26-10-16-1-6-24(28-12-16)31-22-7-8-32(15-23(22)33)34-20-4-2-17(3-5-20)18-9-21-19(11-27)14-30-25(21)29-13-18/h1-6,9,12-14,22-23,33H,7-8,15H2,(H,28,31)(H,29,30) |
| InChIKey | PVSOXIQCEBJKBV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 124.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|