C24H22F3N5S — CID 167479125
N-[1-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]sulfanylpiperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 167479125) has the molecular formula C24H22F3N5S and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[1-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]sulfanylpiperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[1-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]sulfanylpiperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 167479125 |
| Molecular Formula | C24H22F3N5S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N-[1-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]sulfanylpiperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(NC2CCN(Sc3ccc(-c4cnc5[nH]ccc5c4)cc3)CC2)nc1 |
| InChI | InChI=1S/C24H22F3N5S/c25-24(26,27)19-3-6-22(29-15-19)31-20-8-11-32(12-9-20)33-21-4-1-16(2-5-21)18-13-17-7-10-28-23(17)30-14-18/h1-7,10,13-15,20H,8-9,11-12H2,(H,28,30)(H,29,31) |
| InChIKey | IVKWEQOYLCXINE-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|