C25H23F3N4S — CID 167479187
N-[1-[4-(1H-indol-5-yl)phenyl]sulfanylpiperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 167479187) has the molecular formula C25H23F3N4S and a molecular weight of 468.55 g/mol. Its IUPAC name is N-[1-[4-(1H-indol-5-yl)phenyl]sulfanylpiperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[1-[4-(1H-indol-5-yl)phenyl]sulfanylpiperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 167479187 |
| Molecular Formula | C25H23F3N4S |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | N-[1-[4-(1H-indol-5-yl)phenyl]sulfanylpiperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(NC2CCN(Sc3ccc(-c4ccc5[nH]ccc5c4)cc3)CC2)nc1 |
| InChI | InChI=1S/C25H23F3N4S/c26-25(27,28)20-4-8-24(30-16-20)31-21-10-13-32(14-11-21)33-22-5-1-17(2-6-22)18-3-7-23-19(15-18)9-12-29-23/h1-9,12,15-16,21,29H,10-11,13-14H2,(H,30,31) |
| InChIKey | OEIHBOAILVCTOB-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|