C25H24F3N5OS — CID 167479352
6-[4-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]-3,4-dihydro-1H-quinazolin-2-one (PubChem CID 167479352) has the molecular formula C25H24F3N5OS and a molecular weight of 499.56 g/mol. Its IUPAC name is 6-[4-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]-3,4-dihydro-1H-quinazolin-2-one.
| Compound Name | 6-[4-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]-3,4-dihydro-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 167479352 |
| Molecular Formula | C25H24F3N5OS |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 6-[4-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]sulfanylphenyl]-3,4-dihydro-1H-quinazolin-2-one |
| SMILES | O=C1NCc2cc(-c3ccc(SN4CCC(Nc5ccc(C(F)(F)F)cn5)CC4)cc3)ccc2N1 |
| InChI | InChI=1S/C25H24F3N5OS/c26-25(27,28)19-4-8-23(29-15-19)31-20-9-11-33(12-10-20)35-21-5-1-16(2-6-21)17-3-7-22-18(13-17)14-30-24(34)32-22/h1-8,13,15,20H,9-12,14H2,(H,29,31)(H2,30,32,34) |
| InChIKey | FDZICHONMPHGFB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|