C15H11F3N2O — CID 12001469
6-[6-(trifluoromethyl)-3-pyridinyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 12001469) has the molecular formula C15H11F3N2O and a molecular weight of 292.26 g/mol. Its IUPAC name is 6-[6-(trifluoromethyl)-3-pyridinyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[6-(trifluoromethyl)-3-pyridinyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 12001469 |
| Molecular Formula | C15H11F3N2O |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 6-[6-(trifluoromethyl)-3-pyridinyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(-c3ccc(C(F)(F)F)nc3)ccc2N1 |
| InChI | InChI=1S/C15H11F3N2O/c16-15(17,18)13-5-2-11(8-19-13)9-1-4-12-10(7-9)3-6-14(21)20-12/h1-2,4-5,7-8H,3,6H2,(H,20,21) |
| InChIKey | LNNURERXCOZVEV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |