C23H17N3O — CID 59860167
6-(4-pyridin-4-ylquinolin-6-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 59860167) has the molecular formula C23H17N3O and a molecular weight of 351.41 g/mol. Its IUPAC name is 6-(4-pyridin-4-ylquinolin-6-yl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(4-pyridin-4-ylquinolin-6-yl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 59860167 |
| Molecular Formula | C23H17N3O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 6-(4-pyridin-4-ylquinolin-6-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(-c3ccc4nccc(-c5ccncc5)c4c3)ccc2N1 |
| InChI | InChI=1S/C23H17N3O/c27-23-6-3-18-13-16(1-4-21(18)26-23)17-2-5-22-20(14-17)19(9-12-25-22)15-7-10-24-11-8-15/h1-2,4-5,7-14H,3,6H2,(H,26,27) |
| InChIKey | MVOJFQBLTJAKLI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |