C18H13FN2O — CID 164550234
6-(6-fluoroquinolin-2-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 164550234) has the molecular formula C18H13FN2O and a molecular weight of 292.31 g/mol. Its IUPAC name is 6-(6-fluoroquinolin-2-yl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(6-fluoroquinolin-2-yl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 164550234 |
| Molecular Formula | C18H13FN2O |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 6-(6-fluoroquinolin-2-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(-c3ccc4cc(F)ccc4n3)ccc2N1 |
| InChI | InChI=1S/C18H13FN2O/c19-14-4-7-16-13(10-14)2-5-15(20-16)11-1-6-17-12(9-11)3-8-18(22)21-17/h1-2,4-7,9-10H,3,8H2,(H,21,22) |
| InChIKey | OUKUOTSDEMEWEN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |