C12H13N5O — CID 82293668
6-(1,2-diaminoimidazol-4-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 82293668) has the molecular formula C12H13N5O and a molecular weight of 243.27 g/mol. Its IUPAC name is 6-(1,2-diaminoimidazol-4-yl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(1,2-diaminoimidazol-4-yl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 82293668 |
| Molecular Formula | C12H13N5O |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 6-(1,2-diaminoimidazol-4-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Nc1nc(-c2ccc3c(c2)CCC(=O)N3)cn1N |
| InChI | InChI=1S/C12H13N5O/c13-12-16-10(6-17(12)14)8-1-3-9-7(5-8)2-4-11(18)15-9/h1,3,5-6H,2,4,14H2,(H2,13,16)(H,15,18) |
| InChIKey | DGGLFCMYMDWERD-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |