C14H15N3O2 — CID 116832062
6-(2-amino-4-ethyl-1,3-oxazol-5-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 116832062) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 6-(2-amino-4-ethyl-1,3-oxazol-5-yl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(2-amino-4-ethyl-1,3-oxazol-5-yl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 116832062 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 6-(2-amino-4-ethyl-1,3-oxazol-5-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCc1nc(N)oc1-c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C14H15N3O2/c1-2-10-13(19-14(15)17-10)9-3-5-11-8(7-9)4-6-12(18)16-11/h3,5,7H,2,4,6H2,1H3,(H2,15,17)(H,16,18) |
| InChIKey | VKSBFHPYNXKPAC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |