C16H13ClFNO — CID 61083566
6-[chloro-(3-fluorophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 61083566) has the molecular formula C16H13ClFNO and a molecular weight of 289.74 g/mol. Its IUPAC name is 6-[chloro-(3-fluorophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[chloro-(3-fluorophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 61083566 |
| Molecular Formula | C16H13ClFNO |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 6-[chloro-(3-fluorophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(Cl)c3cccc(F)c3)ccc2N1 |
| InChI | InChI=1S/C16H13ClFNO/c17-16(11-2-1-3-13(18)9-11)12-4-6-14-10(8-12)5-7-15(20)19-14/h1-4,6,8-9,16H,5,7H2,(H,19,20) |
| InChIKey | PHUQQIWFOQJPOH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|