C15H12FNO2 — CID 61088889
5-[(3-fluorophenyl)-hydroxymethyl]-1,3-dihydroindol-2-one (PubChem CID 61088889) has the molecular formula C15H12FNO2 and a molecular weight of 257.26 g/mol. Its IUPAC name is 5-[(3-fluorophenyl)-hydroxymethyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[(3-fluorophenyl)-hydroxymethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 61088889 |
| Molecular Formula | C15H12FNO2 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 5-[(3-fluorophenyl)-hydroxymethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(O)c3cccc(F)c3)ccc2N1 |
| InChI | InChI=1S/C15H12FNO2/c16-12-3-1-2-9(7-12)15(19)10-4-5-13-11(6-10)8-14(18)17-13/h1-7,15,19H,8H2,(H,17,18) |
| InChIKey | OEZOQFUJNLJSCR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |