C15H11F2NO2 — CID 61087016
5-[(3,5-difluorophenyl)-hydroxymethyl]-1,3-dihydroindol-2-one (PubChem CID 61087016) has the molecular formula C15H11F2NO2 and a molecular weight of 275.25 g/mol. Its IUPAC name is 5-[(3,5-difluorophenyl)-hydroxymethyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[(3,5-difluorophenyl)-hydroxymethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 61087016 |
| Molecular Formula | C15H11F2NO2 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 5-[(3,5-difluorophenyl)-hydroxymethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(O)c3cc(F)cc(F)c3)ccc2N1 |
| InChI | InChI=1S/C15H11F2NO2/c16-11-4-10(5-12(17)7-11)15(20)8-1-2-13-9(3-8)6-14(19)18-13/h1-5,7,15,20H,6H2,(H,18,19) |
| InChIKey | MOLCSKXPUYTWQU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |