C15H10F3NO2 — CID 79755388
5-[hydroxy-(2,3,4-trifluorophenyl)methyl]-1,3-dihydroindol-2-one (PubChem CID 79755388) has the molecular formula C15H10F3NO2 and a molecular weight of 293.24 g/mol. Its IUPAC name is 5-[hydroxy-(2,3,4-trifluorophenyl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[hydroxy-(2,3,4-trifluorophenyl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79755388 |
| Molecular Formula | C15H10F3NO2 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 5-[hydroxy-(2,3,4-trifluorophenyl)methyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(O)c3ccc(F)c(F)c3F)ccc2N1 |
| InChI | InChI=1S/C15H10F3NO2/c16-10-3-2-9(13(17)14(10)18)15(21)7-1-4-11-8(5-7)6-12(20)19-11/h1-5,15,21H,6H2,(H,19,20) |
| InChIKey | ONKPKWKPHOTXER-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|