C19H14N4O2S — CID 25121265
5-(4-pyridin-4-ylquinolin-6-yl)pyridine-3-sulfonamide (PubChem CID 25121265) has the molecular formula C19H14N4O2S and a molecular weight of 362.41 g/mol. Its IUPAC name is 5-(4-pyridin-4-ylquinolin-6-yl)pyridine-3-sulfonamide.
| Compound Name | 5-(4-pyridin-4-ylquinolin-6-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 25121265 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 5-(4-pyridin-4-ylquinolin-6-yl)pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cncc(-c2ccc3nccc(-c4ccncc4)c3c2)c1 |
| InChI | InChI=1S/C19H14N4O2S/c20-26(24,25)16-9-15(11-22-12-16)14-1-2-19-18(10-14)17(5-8-23-19)13-3-6-21-7-4-13/h1-12H,(H2,20,24,25) |
| InChIKey | KYJNKBNDLCXFLA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |