C20H16N4O4S2 — CID 59860041
5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide (PubChem CID 59860041) has the molecular formula C20H16N4O4S2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide.
| Compound Name | 5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 59860041 |
| Molecular Formula | C20H16N4O4S2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cncc(-c2ccc3nccc(-c4cccc(S(N)(=O)=O)c4)c3c2)c1 |
| InChI | InChI=1S/C20H16N4O4S2/c21-29(25,26)16-3-1-2-14(8-16)18-6-7-24-20-5-4-13(10-19(18)20)15-9-17(12-23-11-15)30(22,27)28/h1-12H,(H2,21,25,26)(H2,22,27,28) |
| InChIKey | NUZJHJWGUPXLMQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |