C12H15F3N2O2S — CID 164877980
4-[[5-(trifluoromethyl)-2-pyridinyl]amino]cyclohexane-1-sulfinic acid (PubChem CID 164877980) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.32 g/mol. Its IUPAC name is 4-[[5-(trifluoromethyl)-2-pyridinyl]amino]cyclohexane-1-sulfinic acid.
| Compound Name | 4-[[5-(trifluoromethyl)-2-pyridinyl]amino]cyclohexane-1-sulfinic acid |
|---|---|
| PubChem CID | 164877980 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4-[[5-(trifluoromethyl)-2-pyridinyl]amino]cyclohexane-1-sulfinic acid |
| SMILES | O=S(O)C1CCC(Nc2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C12H15F3N2O2S/c13-12(14,15)8-1-6-11(16-7-8)17-9-2-4-10(5-3-9)20(18)19/h1,6-7,9-10H,2-5H2,(H,16,17)(H,18,19) |
| InChIKey | JAECCZWXOBFPCU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|